C8H14N4O2S — CID 62897666
4-(2-morpholin-4-ylethyl)-5-sulfanylidene-1,2,4-triazolidin-3-one (PubChem CID 62897666) has the molecular formula C8H14N4O2S and a molecular weight of 230.29 g/mol. Its IUPAC name is 4-(2-morpholin-4-ylethyl)-5-sulfanylidene-1,2,4-triazolidin-3-one.
| Compound Name | 4-(2-morpholin-4-ylethyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
|---|---|
| PubChem CID | 62897666 |
| Molecular Formula | C8H14N4O2S |
| Molecular Weight | 230.29 g/mol |
| Exact Mass | 230.08 |
| IUPAC Name | 4-(2-morpholin-4-ylethyl)-5-sulfanylidene-1,2,4-triazolidin-3-one |
| SMILES | O=c1[nH][nH]c(=S)n1CCN1CCOCC1 |
| InChI | InChI=1S/C8H14N4O2S/c13-7-9-10-8(15)12(7)2-1-11-3-5-14-6-4-11/h1-6H2,(H,9,13)(H,10,15) |
| InChIKey | JOOASFVYKZIWFR-UHFFFAOYSA-N |
| XLogP | -0.43 |
| TPSA | 66.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.29 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|