About 3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione
3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione (PubChem CID 15475916) has the molecular formula C9H16N2OS2
and a molecular weight of 232.37 g/mol. Its IUPAC name is 3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione.
Molecular Properties
| Compound Name | 3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione |
| PubChem CID | 15475916 |
| Molecular Formula | C9H16N2OS2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione |
| SMILES | S=C1SCCN1CCN1CCOCC1 |
| InChI | InChI=1S/C9H16N2OS2/c13-9-11(5-8-14-9)2-1-10-3-6-12-7-4-10/h1-8H2 |
| InChIKey | HLZUFMFYGOZVRE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione?
The IUPAC name of 3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione (CID 15475916) is 3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione.
What is the SMILES notation for 3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione?
The canonical SMILES for 3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione is S=C1SCCN1CCN1CCOCC1.
What is the InChIKey of 3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione?
The InChIKey is HLZUFMFYGOZVRE-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H16N2OS2/c13-9-11(5-8-14-9)2-1-10-3-6-12-7-4-10/h1-8H2.
What are the key properties of 3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione?
3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione has a molecular weight of 232.37 g/mol, XLogP of 0.65, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione is sourced from PubChem (CID 15475916), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).