C9H16N2OS2 — CID 15475916
3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione (PubChem CID 15475916) has the molecular formula C9H16N2OS2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione.
| Compound Name | 3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione |
|---|---|
| PubChem CID | 15475916 |
| Molecular Formula | C9H16N2OS2 |
| Molecular Weight | 232.37 g/mol |
| Exact Mass | 232.07 |
| IUPAC Name | 3-(2-morpholin-4-ylethyl)-1,3-thiazolidine-2-thione |
| SMILES | S=C1SCCN1CCN1CCOCC1 |
| InChI | InChI=1S/C9H16N2OS2/c13-9-11(5-8-14-9)2-1-10-3-6-12-7-4-10/h1-8H2 |
| InChIKey | HLZUFMFYGOZVRE-UHFFFAOYSA-N |
| XLogP | 0.65 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.37 |
| LogP ≤ 5 | 0.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|