C14H25N3OS2 — CID 23969357
3-cyclopentyl-5-(2-morpholin-4-ylethyl)-1,3,5-thiadiazinane-2-thione (PubChem CID 23969357) has the molecular formula C14H25N3OS2 and a molecular weight of 315.51 g/mol. Its IUPAC name is 3-cyclopentyl-5-(2-morpholin-4-ylethyl)-1,3,5-thiadiazinane-2-thione.
| Compound Name | 3-cyclopentyl-5-(2-morpholin-4-ylethyl)-1,3,5-thiadiazinane-2-thione |
|---|---|
| PubChem CID | 23969357 |
| Molecular Formula | C14H25N3OS2 |
| Molecular Weight | 315.51 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | 3-cyclopentyl-5-(2-morpholin-4-ylethyl)-1,3,5-thiadiazinane-2-thione |
| SMILES | S=C1SCN(CCN2CCOCC2)CN1C1CCCC1 |
| InChI | InChI=1S/C14H25N3OS2/c19-14-17(13-3-1-2-4-13)11-16(12-20-14)6-5-15-7-9-18-10-8-15/h13H,1-12H2 |
| InChIKey | XXHWBTWZWZRCLX-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 18.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.51 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|