C11H14N2O2S — CID 62897971
4-(2-thiophen-2-ylacetyl)-1,4-diazepan-2-one (PubChem CID 62897971) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is 4-(2-thiophen-2-ylacetyl)-1,4-diazepan-2-one.
| Compound Name | 4-(2-thiophen-2-ylacetyl)-1,4-diazepan-2-one |
|---|---|
| PubChem CID | 62897971 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | 4-(2-thiophen-2-ylacetyl)-1,4-diazepan-2-one |
| SMILES | O=C1CN(C(=O)Cc2cccs2)CCCN1 |
| InChI | InChI=1S/C11H14N2O2S/c14-10-8-13(5-2-4-12-10)11(15)7-9-3-1-6-16-9/h1,3,6H,2,4-5,7-8H2,(H,12,14) |
| InChIKey | OENAPWGIYUQKQB-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |