C10H13N3O2 — CID 62903126
2-cyano-2-ethyl-N-(1,2-oxazol-4-yl)butanamide (PubChem CID 62903126) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2-cyano-2-ethyl-N-(1,2-oxazol-4-yl)butanamide.
| Compound Name | 2-cyano-2-ethyl-N-(1,2-oxazol-4-yl)butanamide |
|---|---|
| PubChem CID | 62903126 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2-cyano-2-ethyl-N-(1,2-oxazol-4-yl)butanamide |
| SMILES | CCC(C#N)(CC)C(=O)Nc1cnoc1 |
| InChI | InChI=1S/C10H13N3O2/c1-3-10(4-2,7-11)9(14)13-8-5-12-15-6-8/h5-6H,3-4H2,1-2H3,(H,13,14) |
| InChIKey | ONROQWVOUFYZNN-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |