C15H18BrClN2O2 — CID 62905002
5-bromo-6-[chloro(oxan-4-yl)methyl]-1,3-dimethylbenzimidazol-2-one (PubChem CID 62905002) has the molecular formula C15H18BrClN2O2 and a molecular weight of 373.68 g/mol. Its IUPAC name is 5-bromo-6-[chloro(oxan-4-yl)methyl]-1,3-dimethylbenzimidazol-2-one.
| Compound Name | 5-bromo-6-[chloro(oxan-4-yl)methyl]-1,3-dimethylbenzimidazol-2-one |
|---|---|
| PubChem CID | 62905002 |
| Molecular Formula | C15H18BrClN2O2 |
| Molecular Weight | 373.68 g/mol |
| Exact Mass | 372.02 |
| IUPAC Name | 5-bromo-6-[chloro(oxan-4-yl)methyl]-1,3-dimethylbenzimidazol-2-one |
| SMILES | Cn1c(=O)n(C)c2cc(C(Cl)C3CCOCC3)c(Br)cc21 |
| InChI | InChI=1S/C15H18BrClN2O2/c1-18-12-7-10(14(17)9-3-5-21-6-4-9)11(16)8-13(12)19(2)15(18)20/h7-9,14H,3-6H2,1-2H3 |
| InChIKey | VULFJCAZUJRGGM-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 36.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.68 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|