C13H22N2 — CID 62910591
1-N,4-dimethyl-1-N-pentan-3-ylbenzene-1,3-diamine (PubChem CID 62910591) has the molecular formula C13H22N2 and a molecular weight of 206.33 g/mol. Its IUPAC name is 1-N,4-dimethyl-1-N-pentan-3-ylbenzene-1,3-diamine.
| Compound Name | 1-N,4-dimethyl-1-N-pentan-3-ylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 62910591 |
| Molecular Formula | C13H22N2 |
| Molecular Weight | 206.33 g/mol |
| Exact Mass | 206.18 |
| IUPAC Name | 1-N,4-dimethyl-1-N-pentan-3-ylbenzene-1,3-diamine |
| SMILES | CCC(CC)N(C)c1ccc(C)c(N)c1 |
| InChI | InChI=1S/C13H22N2/c1-5-11(6-2)15(4)12-8-7-10(3)13(14)9-12/h7-9,11H,5-6,14H2,1-4H3 |
| InChIKey | SCUVODZODDZOHU-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.33 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|