C13H15F3O3 — CID 62918574
2-(oxolan-2-yl)-1-[3-(trifluoromethoxy)phenyl]ethanol (PubChem CID 62918574) has the molecular formula C13H15F3O3 and a molecular weight of 276.25 g/mol. Its IUPAC name is 2-(oxolan-2-yl)-1-[3-(trifluoromethoxy)phenyl]ethanol.
| Compound Name | 2-(oxolan-2-yl)-1-[3-(trifluoromethoxy)phenyl]ethanol |
|---|---|
| PubChem CID | 62918574 |
| Molecular Formula | C13H15F3O3 |
| Molecular Weight | 276.25 g/mol |
| Exact Mass | 276.10 |
| IUPAC Name | 2-(oxolan-2-yl)-1-[3-(trifluoromethoxy)phenyl]ethanol |
| SMILES | OC(CC1CCCO1)c1cccc(OC(F)(F)F)c1 |
| InChI | InChI=1S/C13H15F3O3/c14-13(15,16)19-11-4-1-3-9(7-11)12(17)8-10-5-2-6-18-10/h1,3-4,7,10,12,17H,2,5-6,8H2 |
| InChIKey | QUGCQHSGCSSUEG-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.25 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |