C17H19ClN2O3 — CID 629206
2-[(tert-butylamino)methyl]-6-(4-chlorophenyl)-4-nitrophenol (PubChem CID 629206) has the molecular formula C17H19ClN2O3 and a molecular weight of 334.80 g/mol. Its IUPAC name is 2-[(tert-butylamino)methyl]-6-(4-chlorophenyl)-4-nitrophenol.
| Compound Name | 2-[(tert-butylamino)methyl]-6-(4-chlorophenyl)-4-nitrophenol |
|---|---|
| PubChem CID | 629206 |
| Molecular Formula | C17H19ClN2O3 |
| Molecular Weight | 334.80 g/mol |
| Exact Mass | 334.11 |
| IUPAC Name | 2-[(tert-butylamino)methyl]-6-(4-chlorophenyl)-4-nitrophenol |
| SMILES | CC(C)(C)NCc1cc([N+](=O)[O-])cc(-c2ccc(Cl)cc2)c1O |
| InChI | InChI=1S/C17H19ClN2O3/c1-17(2,3)19-10-12-8-14(20(22)23)9-15(16(12)21)11-4-6-13(18)7-5-11/h4-9,19,21H,10H2,1-3H3 |
| InChIKey | KECZXKQQQUINPZ-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 75.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.80 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|