C20H28Cl2N2O — CID 86718568
4-tert-butyl-2-[(tert-butylamino)methyl]-6-(6-chloro-3-pyridinyl)phenol;hydrochloride (PubChem CID 86718568) has the molecular formula C20H28Cl2N2O and a molecular weight of 383.36 g/mol. Its IUPAC name is 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(6-chloro-3-pyridinyl)phenol;hydrochloride.
| Compound Name | 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(6-chloro-3-pyridinyl)phenol;hydrochloride |
|---|---|
| PubChem CID | 86718568 |
| Molecular Formula | C20H28Cl2N2O |
| Molecular Weight | 383.36 g/mol |
| Exact Mass | 382.16 |
| IUPAC Name | 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(6-chloro-3-pyridinyl)phenol;hydrochloride |
| SMILES | CC(C)(C)NCc1cc(C(C)(C)C)cc(-c2ccc(Cl)nc2)c1O.Cl |
| InChI | InChI=1S/C20H27ClN2O.ClH/c1-19(2,3)15-9-14(12-23-20(4,5)6)18(24)16(10-15)13-7-8-17(21)22-11-13;/h7-11,23-24H,12H2,1-6H3;1H |
| InChIKey | RJNGVZGTDRFERQ-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.36 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|