C20H28F3N3O — CID 136601807
4-tert-butyl-2-[(tert-butylamino)methyl]-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenol (PubChem CID 136601807) has the molecular formula C20H28F3N3O and a molecular weight of 383.46 g/mol. Its IUPAC name is 4-tert-butyl-2-[(tert-butylamino)methyl]-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenol.
| Compound Name | 4-tert-butyl-2-[(tert-butylamino)methyl]-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenol |
|---|---|
| PubChem CID | 136601807 |
| Molecular Formula | C20H28F3N3O |
| Molecular Weight | 383.46 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | 4-tert-butyl-2-[(tert-butylamino)methyl]-6-[1-methyl-3-(trifluoromethyl)pyrazol-5-yl]phenol |
| SMILES | Cn1nc(C(F)(F)F)cc1-c1cc(C(C)(C)C)cc(CNC(C)(C)C)c1O |
| InChI | InChI=1S/C20H28F3N3O/c1-18(2,3)13-8-12(11-24-19(4,5)6)17(27)14(9-13)15-10-16(20(21,22)23)25-26(15)7/h8-10,24,27H,11H2,1-7H3 |
| InChIKey | OPDQMTXABLNHDG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 50.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|