C21H27F3N2O — CID 136601811
4-tert-butyl-2-[(tert-butylamino)methyl]-6-[4-(trifluoromethyl)-2-pyridinyl]phenol (PubChem CID 136601811) has the molecular formula C21H27F3N2O and a molecular weight of 380.45 g/mol. Its IUPAC name is 4-tert-butyl-2-[(tert-butylamino)methyl]-6-[4-(trifluoromethyl)-2-pyridinyl]phenol.
| Compound Name | 4-tert-butyl-2-[(tert-butylamino)methyl]-6-[4-(trifluoromethyl)-2-pyridinyl]phenol |
|---|---|
| PubChem CID | 136601811 |
| Molecular Formula | C21H27F3N2O |
| Molecular Weight | 380.45 g/mol |
| Exact Mass | 380.21 |
| IUPAC Name | 4-tert-butyl-2-[(tert-butylamino)methyl]-6-[4-(trifluoromethyl)-2-pyridinyl]phenol |
| SMILES | CC(C)(C)NCc1cc(C(C)(C)C)cc(-c2cc(C(F)(F)F)ccn2)c1O |
| InChI | InChI=1S/C21H27F3N2O/c1-19(2,3)15-9-13(12-26-20(4,5)6)18(27)16(10-15)17-11-14(7-8-25-17)21(22,23)24/h7-11,26-27H,12H2,1-6H3 |
| InChIKey | MHDDXVGOBQUTJN-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 45.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.45 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|