About 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride
4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride (PubChem CID 86718734) has the molecular formula C21H28Cl2FNO
and a molecular weight of 400.37 g/mol. Its IUPAC name is 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride.
Molecular Properties
| Compound Name | 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride |
| PubChem CID | 86718734 |
| Molecular Formula | C21H28Cl2FNO |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride |
| SMILES | CC(C)(C)NCc1cc(C(C)(C)C)cc(-c2ccc(F)c(Cl)c2)c1O.Cl |
| InChI | InChI=1S/C21H27ClFNO.ClH/c1-20(2,3)15-9-14(12-24-21(4,5)6)19(25)16(11-15)13-7-8-18(23)17(22)10-13;/h7-11,24-25H,12H2,1-6H3;1H |
| InChIKey | SZGAIFBAQGECDO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|
Analyze 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride?
The IUPAC name of 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride (CID 86718734) is 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride.
What is the SMILES notation for 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride?
The canonical SMILES for 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride is CC(C)(C)NCc1cc(C(C)(C)C)cc(-c2ccc(F)c(Cl)c2)c1O.Cl.
What is the InChIKey of 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride?
The InChIKey is SZGAIFBAQGECDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H27ClFNO.ClH/c1-20(2,3)15-9-14(12-24-21(4,5)6)19(25)16(11-15)13-7-8-18(23)17(22)10-13;/h7-11,24-25H,12H2,1-6H3;1H.
What are the key properties of 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride?
4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride has a molecular weight of 400.37 g/mol, XLogP of 6.46, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride is sourced from PubChem (CID 86718734), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).