C21H28Cl2FNO — CID 86718734
4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride (PubChem CID 86718734) has the molecular formula C21H28Cl2FNO and a molecular weight of 400.37 g/mol. Its IUPAC name is 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride.
| Compound Name | 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride |
|---|---|
| PubChem CID | 86718734 |
| Molecular Formula | C21H28Cl2FNO |
| Molecular Weight | 400.37 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 4-tert-butyl-2-[(tert-butylamino)methyl]-6-(3-chloro-4-fluorophenyl)phenol;hydrochloride |
| SMILES | CC(C)(C)NCc1cc(C(C)(C)C)cc(-c2ccc(F)c(Cl)c2)c1O.Cl |
| InChI | InChI=1S/C21H27ClFNO.ClH/c1-20(2,3)15-9-14(12-24-21(4,5)6)19(25)16(11-15)13-7-8-18(23)17(22)10-13;/h7-11,24-25H,12H2,1-6H3;1H |
| InChIKey | SZGAIFBAQGECDO-UHFFFAOYSA-N |
| XLogP | 6.46 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.37 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|