C10H18N4O3 — CID 62921745
N,N-bis(2-amino-2-oxoethyl)-3-(cyclopropylamino)propanamide (PubChem CID 62921745) has the molecular formula C10H18N4O3 and a molecular weight of 242.28 g/mol. Its IUPAC name is N,N-bis(2-amino-2-oxoethyl)-3-(cyclopropylamino)propanamide.
| Compound Name | N,N-bis(2-amino-2-oxoethyl)-3-(cyclopropylamino)propanamide |
|---|---|
| PubChem CID | 62921745 |
| Molecular Formula | C10H18N4O3 |
| Molecular Weight | 242.28 g/mol |
| Exact Mass | 242.14 |
| IUPAC Name | N,N-bis(2-amino-2-oxoethyl)-3-(cyclopropylamino)propanamide |
| SMILES | NC(=O)CN(CC(N)=O)C(=O)CCNC1CC1 |
| InChI | InChI=1S/C10H18N4O3/c11-8(15)5-14(6-9(12)16)10(17)3-4-13-7-1-2-7/h7,13H,1-6H2,(H2,11,15)(H2,12,16) |
| InChIKey | CFAOJMHSHMAFDP-UHFFFAOYSA-N |
| XLogP | -2.07 |
| TPSA | 118.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.28 |
| LogP ≤ 5 | -2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |