C13H27N3O — CID 79731374
3-[(4-aminocyclohexyl)amino]-N,N-diethylpropanamide (PubChem CID 79731374) has the molecular formula C13H27N3O and a molecular weight of 241.38 g/mol. Its IUPAC name is 3-[(4-aminocyclohexyl)amino]-N,N-diethylpropanamide.
| Compound Name | 3-[(4-aminocyclohexyl)amino]-N,N-diethylpropanamide |
|---|---|
| PubChem CID | 79731374 |
| Molecular Formula | C13H27N3O |
| Molecular Weight | 241.38 g/mol |
| Exact Mass | 241.22 |
| IUPAC Name | 3-[(4-aminocyclohexyl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNC1CCC(N)CC1 |
| InChI | InChI=1S/C13H27N3O/c1-3-16(4-2)13(17)9-10-15-12-7-5-11(14)6-8-12/h11-12,15H,3-10,14H2,1-2H3 |
| InChIKey | SXIBHTPRDKJNDV-UHFFFAOYSA-N |
| XLogP | 1.10 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.38 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |