About 3-[(3-aminocyclobutyl)amino]-N,N-diethylpropanamide
3-[(3-aminocyclobutyl)amino]-N,N-diethylpropanamide (PubChem CID 80560855) has the molecular formula C11H23N3O
and a molecular weight of 213.32 g/mol. Its IUPAC name is 3-[(3-aminocyclobutyl)amino]-N,N-diethylpropanamide.
Molecular Properties
| Compound Name | 3-[(3-aminocyclobutyl)amino]-N,N-diethylpropanamide |
| PubChem CID | 80560855 |
| Molecular Formula | C11H23N3O |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.18 |
| IUPAC Name | 3-[(3-aminocyclobutyl)amino]-N,N-diethylpropanamide |
| SMILES | CCN(CC)C(=O)CCNC1CC(N)C1 |
| InChI | InChI=1S/C11H23N3O/c1-3-14(4-2)11(15)5-6-13-10-7-9(12)8-10/h9-10,13H,3-8,12H2,1-2H3 |
| InChIKey | IFFPUKSWQKHSQQ-UHFFFAOYSA-N |
| XLogP | 0.32 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 0.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-[(3-aminocyclobutyl)amino]-N,N-diethylpropanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-[(3-aminocyclobutyl)amino]-N,N-diethylpropanamide?
The IUPAC name of 3-[(3-aminocyclobutyl)amino]-N,N-diethylpropanamide (CID 80560855) is 3-[(3-aminocyclobutyl)amino]-N,N-diethylpropanamide.
What is the SMILES notation for 3-[(3-aminocyclobutyl)amino]-N,N-diethylpropanamide?
The canonical SMILES for 3-[(3-aminocyclobutyl)amino]-N,N-diethylpropanamide is CCN(CC)C(=O)CCNC1CC(N)C1.
What is the InChIKey of 3-[(3-aminocyclobutyl)amino]-N,N-diethylpropanamide?
The InChIKey is IFFPUKSWQKHSQQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H23N3O/c1-3-14(4-2)11(15)5-6-13-10-7-9(12)8-10/h9-10,13H,3-8,12H2,1-2H3.
What are the key properties of 3-[(3-aminocyclobutyl)amino]-N,N-diethylpropanamide?
3-[(3-aminocyclobutyl)amino]-N,N-diethylpropanamide has a molecular weight of 213.32 g/mol, XLogP of 0.32, 6 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-[(3-aminocyclobutyl)amino]-N,N-diethylpropanamide is sourced from PubChem (CID 80560855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).