C15H18N2O4 — CID 62930547
5-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-3,3-dimethylpentanoic acid (PubChem CID 62930547) has the molecular formula C15H18N2O4 and a molecular weight of 290.32 g/mol. Its IUPAC name is 5-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-3,3-dimethylpentanoic acid.
| Compound Name | 5-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-3,3-dimethylpentanoic acid |
|---|---|
| PubChem CID | 62930547 |
| Molecular Formula | C15H18N2O4 |
| Molecular Weight | 290.32 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 5-(2,3-dioxo-1,4-dihydroquinoxalin-6-yl)-3,3-dimethylpentanoic acid |
| SMILES | CC(C)(CCc1ccc2[nH]c(=O)c(=O)[nH]c2c1)CC(=O)O |
| InChI | InChI=1S/C15H18N2O4/c1-15(2,8-12(18)19)6-5-9-3-4-10-11(7-9)17-14(21)13(20)16-10/h3-4,7H,5-6,8H2,1-2H3,(H,16,20)(H,17,21)(H,18,19) |
| InChIKey | UAWJQLMDSZEMQZ-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 103.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.32 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|