C12H20N2O4 — CID 62934121
4-[5-(2-ethoxyethyl)-1,3,4-oxadiazol-2-yl]-3,3-dimethylbutanoic acid (PubChem CID 62934121) has the molecular formula C12H20N2O4 and a molecular weight of 256.30 g/mol. Its IUPAC name is 4-[5-(2-ethoxyethyl)-1,3,4-oxadiazol-2-yl]-3,3-dimethylbutanoic acid.
| Compound Name | 4-[5-(2-ethoxyethyl)-1,3,4-oxadiazol-2-yl]-3,3-dimethylbutanoic acid |
|---|---|
| PubChem CID | 62934121 |
| Molecular Formula | C12H20N2O4 |
| Molecular Weight | 256.30 g/mol |
| Exact Mass | 256.14 |
| IUPAC Name | 4-[5-(2-ethoxyethyl)-1,3,4-oxadiazol-2-yl]-3,3-dimethylbutanoic acid |
| SMILES | CCOCCc1nnc(CC(C)(C)CC(=O)O)o1 |
| InChI | InChI=1S/C12H20N2O4/c1-4-17-6-5-9-13-14-10(18-9)7-12(2,3)8-11(15)16/h4-8H2,1-3H3,(H,15,16) |
| InChIKey | SSFLCFDVPYIVMG-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.30 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|