C16H25NO2 — CID 62934522
methyl 5-amino-5-(3,4-dimethylphenyl)-3,3-dimethylpentanoate (PubChem CID 62934522) has the molecular formula C16H25NO2 and a molecular weight of 263.38 g/mol. Its IUPAC name is methyl 5-amino-5-(3,4-dimethylphenyl)-3,3-dimethylpentanoate.
| Compound Name | methyl 5-amino-5-(3,4-dimethylphenyl)-3,3-dimethylpentanoate |
|---|---|
| PubChem CID | 62934522 |
| Molecular Formula | C16H25NO2 |
| Molecular Weight | 263.38 g/mol |
| Exact Mass | 263.19 |
| IUPAC Name | methyl 5-amino-5-(3,4-dimethylphenyl)-3,3-dimethylpentanoate |
| SMILES | COC(=O)CC(C)(C)CC(N)c1ccc(C)c(C)c1 |
| InChI | InChI=1S/C16H25NO2/c1-11-6-7-13(8-12(11)2)14(17)9-16(3,4)10-15(18)19-5/h6-8,14H,9-10,17H2,1-5H3 |
| InChIKey | OKTGFAMBGZHAMT-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |