C14H20INO2 — CID 62932802
methyl 5-amino-5-(4-iodophenyl)-3,3-dimethylpentanoate (PubChem CID 62932802) has the molecular formula C14H20INO2 and a molecular weight of 361.22 g/mol. Its IUPAC name is methyl 5-amino-5-(4-iodophenyl)-3,3-dimethylpentanoate.
| Compound Name | methyl 5-amino-5-(4-iodophenyl)-3,3-dimethylpentanoate |
|---|---|
| PubChem CID | 62932802 |
| Molecular Formula | C14H20INO2 |
| Molecular Weight | 361.22 g/mol |
| Exact Mass | 361.05 |
| IUPAC Name | methyl 5-amino-5-(4-iodophenyl)-3,3-dimethylpentanoate |
| SMILES | COC(=O)CC(C)(C)CC(N)c1ccc(I)cc1 |
| InChI | InChI=1S/C14H20INO2/c1-14(2,9-13(17)18-3)8-12(16)10-4-6-11(15)7-5-10/h4-7,12H,8-9,16H2,1-3H3 |
| InChIKey | TWPPWYCSBQSDNY-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.22 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|