C15H18N2O3 — CID 62936461
3-phenoxypropyl 4-amino-1-methylpyrrole-2-carboxylate (PubChem CID 62936461) has the molecular formula C15H18N2O3 and a molecular weight of 274.32 g/mol. Its IUPAC name is 3-phenoxypropyl 4-amino-1-methylpyrrole-2-carboxylate.
| Compound Name | 3-phenoxypropyl 4-amino-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 62936461 |
| Molecular Formula | C15H18N2O3 |
| Molecular Weight | 274.32 g/mol |
| Exact Mass | 274.13 |
| IUPAC Name | 3-phenoxypropyl 4-amino-1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cc(N)cc1C(=O)OCCCOc1ccccc1 |
| InChI | InChI=1S/C15H18N2O3/c1-17-11-12(16)10-14(17)15(18)20-9-5-8-19-13-6-3-2-4-7-13/h2-4,6-7,10-11H,5,8-9,16H2,1H3 |
| InChIKey | GNIGEKFIADCDNY-UHFFFAOYSA-N |
| XLogP | 2.23 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.32 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|