C17H16N2O3 — CID 71971773
4-phenylbut-3-ynyl 4-carbamoyl-1-methylpyrrole-2-carboxylate (PubChem CID 71971773) has the molecular formula C17H16N2O3 and a molecular weight of 296.33 g/mol. Its IUPAC name is 4-phenylbut-3-ynyl 4-carbamoyl-1-methylpyrrole-2-carboxylate.
| Compound Name | 4-phenylbut-3-ynyl 4-carbamoyl-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 71971773 |
| Molecular Formula | C17H16N2O3 |
| Molecular Weight | 296.33 g/mol |
| Exact Mass | 296.12 |
| IUPAC Name | 4-phenylbut-3-ynyl 4-carbamoyl-1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cc(C(N)=O)cc1C(=O)OCCC#Cc1ccccc1 |
| InChI | InChI=1S/C17H16N2O3/c1-19-12-14(16(18)20)11-15(19)17(21)22-10-6-5-9-13-7-3-2-4-8-13/h2-4,7-8,11-12H,6,10H2,1H3,(H2,18,20) |
| InChIKey | GMTIPZMQRZEGER-UHFFFAOYSA-N |
| XLogP | 1.72 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.33 |
| LogP ≤ 5 | 1.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|