C12H11BrN2O3S — CID 75378891
(4-bromothiophen-2-yl)methyl 4-carbamoyl-1-methylpyrrole-2-carboxylate (PubChem CID 75378891) has the molecular formula C12H11BrN2O3S and a molecular weight of 343.20 g/mol. Its IUPAC name is (4-bromothiophen-2-yl)methyl 4-carbamoyl-1-methylpyrrole-2-carboxylate.
| Compound Name | (4-bromothiophen-2-yl)methyl 4-carbamoyl-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 75378891 |
| Molecular Formula | C12H11BrN2O3S |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 341.97 |
| IUPAC Name | (4-bromothiophen-2-yl)methyl 4-carbamoyl-1-methylpyrrole-2-carboxylate |
| SMILES | Cn1cc(C(N)=O)cc1C(=O)OCc1cc(Br)cs1 |
| InChI | InChI=1S/C12H11BrN2O3S/c1-15-4-7(11(14)16)2-10(15)12(17)18-5-9-3-8(13)6-19-9/h2-4,6H,5H2,1H3,(H2,14,16) |
| InChIKey | QONZKJOESLIVCD-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 74.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |