C13H16N2O5 — CID 97254436
[(1S)-1-cyclopropyl-2-methoxy-2-oxoethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate (PubChem CID 97254436) has the molecular formula C13H16N2O5 and a molecular weight of 280.28 g/mol. Its IUPAC name is [(1S)-1-cyclopropyl-2-methoxy-2-oxoethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate.
| Compound Name | [(1S)-1-cyclopropyl-2-methoxy-2-oxoethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate |
|---|---|
| PubChem CID | 97254436 |
| Molecular Formula | C13H16N2O5 |
| Molecular Weight | 280.28 g/mol |
| Exact Mass | 280.11 |
| IUPAC Name | [(1S)-1-cyclopropyl-2-methoxy-2-oxoethyl] 4-carbamoyl-1-methylpyrrole-2-carboxylate |
| SMILES | COC(=O)[C@@H](OC(=O)c1cc(C(N)=O)cn1C)C1CC1 |
| InChI | InChI=1S/C13H16N2O5/c1-15-6-8(11(14)16)5-9(15)12(17)20-10(7-3-4-7)13(18)19-2/h5-7,10H,3-4H2,1-2H3,(H2,14,16)/t10-/m0/s1 |
| InChIKey | WIEIUXFBHHZUCD-JTQLQIEISA-N |
| XLogP | 0.23 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.28 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |