C11H18N2O2S — CID 62963353
4-[(4-ethyl-1,3-thiazol-2-yl)amino]-4-methylpentanoic acid (PubChem CID 62963353) has the molecular formula C11H18N2O2S and a molecular weight of 242.34 g/mol. Its IUPAC name is 4-[(4-ethyl-1,3-thiazol-2-yl)amino]-4-methylpentanoic acid.
| Compound Name | 4-[(4-ethyl-1,3-thiazol-2-yl)amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 62963353 |
| Molecular Formula | C11H18N2O2S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.11 |
| IUPAC Name | 4-[(4-ethyl-1,3-thiazol-2-yl)amino]-4-methylpentanoic acid |
| SMILES | CCc1csc(NC(C)(C)CCC(=O)O)n1 |
| InChI | InChI=1S/C11H18N2O2S/c1-4-8-7-16-10(12-8)13-11(2,3)6-5-9(14)15/h7H,4-6H2,1-3H3,(H,12,13)(H,14,15) |
| InChIKey | RVYGHUBKZBAUCM-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 62.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |