C13H15F3O — CID 62964767
1-(2,3,4-trifluorophenyl)cycloheptan-1-ol (PubChem CID 62964767) has the molecular formula C13H15F3O and a molecular weight of 244.26 g/mol. Its IUPAC name is 1-(2,3,4-trifluorophenyl)cycloheptan-1-ol.
| Compound Name | 1-(2,3,4-trifluorophenyl)cycloheptan-1-ol |
|---|---|
| PubChem CID | 62964767 |
| Molecular Formula | C13H15F3O |
| Molecular Weight | 244.26 g/mol |
| Exact Mass | 244.11 |
| IUPAC Name | 1-(2,3,4-trifluorophenyl)cycloheptan-1-ol |
| SMILES | OC1(c2ccc(F)c(F)c2F)CCCCCC1 |
| InChI | InChI=1S/C13H15F3O/c14-10-6-5-9(11(15)12(10)16)13(17)7-3-1-2-4-8-13/h5-6,17H,1-4,7-8H2 |
| InChIKey | LXJHTYVUZKPECT-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.26 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|