C9H19NO4 — CID 62966631
N-(2,2-dimethoxyethyl)-3-ethoxypropanamide (PubChem CID 62966631) has the molecular formula C9H19NO4 and a molecular weight of 205.25 g/mol. Its IUPAC name is N-(2,2-dimethoxyethyl)-3-ethoxypropanamide.
| Compound Name | N-(2,2-dimethoxyethyl)-3-ethoxypropanamide |
|---|---|
| PubChem CID | 62966631 |
| Molecular Formula | C9H19NO4 |
| Molecular Weight | 205.25 g/mol |
| Exact Mass | 205.13 |
| IUPAC Name | N-(2,2-dimethoxyethyl)-3-ethoxypropanamide |
| SMILES | CCOCCC(=O)NCC(OC)OC |
| InChI | InChI=1S/C9H19NO4/c1-4-14-6-5-8(11)10-7-9(12-2)13-3/h9H,4-7H2,1-3H3,(H,10,11) |
| InChIKey | SZPBWHBLHBXPCQ-UHFFFAOYSA-N |
| XLogP | 0.15 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.25 |
| LogP ≤ 5 | 0.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|