C15H8ClN5O2 — CID 629679
10-(4-chlorophenyl)pyrido[3,2-g]pteridine-2,4-dione (PubChem CID 629679) has the molecular formula C15H8ClN5O2 and a molecular weight of 325.72 g/mol. Its IUPAC name is 10-(4-chlorophenyl)pyrido[3,2-g]pteridine-2,4-dione.
| Compound Name | 10-(4-chlorophenyl)pyrido[3,2-g]pteridine-2,4-dione |
|---|---|
| PubChem CID | 629679 |
| Molecular Formula | C15H8ClN5O2 |
| Molecular Weight | 325.72 g/mol |
| Exact Mass | 325.04 |
| IUPAC Name | 10-(4-chlorophenyl)pyrido[3,2-g]pteridine-2,4-dione |
| SMILES | O=c1nc2n(-c3ccc(Cl)cc3)c3ncccc3nc-2c(=O)[nH]1 |
| InChI | InChI=1S/C15H8ClN5O2/c16-8-3-5-9(6-4-8)21-12-10(2-1-7-17-12)18-11-13(21)19-15(23)20-14(11)22/h1-7H,(H,20,22,23) |
| InChIKey | QMAOTOVCXYFBMB-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 93.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.72 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|