C15H23ClN2S — CID 62978618
3-(aminomethyl)-N-[1-(3-chlorophenyl)ethyl]-N-methylthian-3-amine (PubChem CID 62978618) has the molecular formula C15H23ClN2S and a molecular weight of 298.88 g/mol. Its IUPAC name is 3-(aminomethyl)-N-[1-(3-chlorophenyl)ethyl]-N-methylthian-3-amine.
| Compound Name | 3-(aminomethyl)-N-[1-(3-chlorophenyl)ethyl]-N-methylthian-3-amine |
|---|---|
| PubChem CID | 62978618 |
| Molecular Formula | C15H23ClN2S |
| Molecular Weight | 298.88 g/mol |
| Exact Mass | 298.13 |
| IUPAC Name | 3-(aminomethyl)-N-[1-(3-chlorophenyl)ethyl]-N-methylthian-3-amine |
| SMILES | CC(c1cccc(Cl)c1)N(C)C1(CN)CCCSC1 |
| InChI | InChI=1S/C15H23ClN2S/c1-12(13-5-3-6-14(16)9-13)18(2)15(10-17)7-4-8-19-11-15/h3,5-6,9,12H,4,7-8,10-11,17H2,1-2H3 |
| InChIKey | NTHRRZXQIXYECO-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.88 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |