C13H13N3S — CID 62982617
3-[(4-ethyl-1,3-thiazol-2-yl)-methylamino]benzonitrile (PubChem CID 62982617) has the molecular formula C13H13N3S and a molecular weight of 243.34 g/mol. Its IUPAC name is 3-[(4-ethyl-1,3-thiazol-2-yl)-methylamino]benzonitrile.
| Compound Name | 3-[(4-ethyl-1,3-thiazol-2-yl)-methylamino]benzonitrile |
|---|---|
| PubChem CID | 62982617 |
| Molecular Formula | C13H13N3S |
| Molecular Weight | 243.34 g/mol |
| Exact Mass | 243.08 |
| IUPAC Name | 3-[(4-ethyl-1,3-thiazol-2-yl)-methylamino]benzonitrile |
| SMILES | CCc1csc(N(C)c2cccc(C#N)c2)n1 |
| InChI | InChI=1S/C13H13N3S/c1-3-11-9-17-13(15-11)16(2)12-6-4-5-10(7-12)8-14/h4-7,9H,3H2,1-2H3 |
| InChIKey | FSPRCKCTGXWWKH-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 39.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.34 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |