C14H22N2OS — CID 62991783
4-(oxan-4-ylsulfanylmethyl)-N-propylpyridin-2-amine (PubChem CID 62991783) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 4-(oxan-4-ylsulfanylmethyl)-N-propylpyridin-2-amine.
| Compound Name | 4-(oxan-4-ylsulfanylmethyl)-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 62991783 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-(oxan-4-ylsulfanylmethyl)-N-propylpyridin-2-amine |
| SMILES | CCCNc1cc(CSC2CCOCC2)ccn1 |
| InChI | InChI=1S/C14H22N2OS/c1-2-6-15-14-10-12(3-7-16-14)11-18-13-4-8-17-9-5-13/h3,7,10,13H,2,4-6,8-9,11H2,1H3,(H,15,16) |
| InChIKey | VHKZDVFZLKXAJN-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |