C14H22N2OS — CID 107756412
4-[(2-methyloxolan-3-yl)sulfanylmethyl]-N-propylpyridin-2-amine (PubChem CID 107756412) has the molecular formula C14H22N2OS and a molecular weight of 266.41 g/mol. Its IUPAC name is 4-[(2-methyloxolan-3-yl)sulfanylmethyl]-N-propylpyridin-2-amine.
| Compound Name | 4-[(2-methyloxolan-3-yl)sulfanylmethyl]-N-propylpyridin-2-amine |
|---|---|
| PubChem CID | 107756412 |
| Molecular Formula | C14H22N2OS |
| Molecular Weight | 266.41 g/mol |
| Exact Mass | 266.15 |
| IUPAC Name | 4-[(2-methyloxolan-3-yl)sulfanylmethyl]-N-propylpyridin-2-amine |
| SMILES | CCCNc1cc(CSC2CCOC2C)ccn1 |
| InChI | InChI=1S/C14H22N2OS/c1-3-6-15-14-9-12(4-7-16-14)10-18-13-5-8-17-11(13)2/h4,7,9,11,13H,3,5-6,8,10H2,1-2H3,(H,15,16) |
| InChIKey | XSNHYIRFXVMHQJ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.41 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |