C15H20O2S — CID 62997185
1-(3,4-dimethylphenyl)-2-(oxan-4-ylsulfanyl)ethanone (PubChem CID 62997185) has the molecular formula C15H20O2S and a molecular weight of 264.39 g/mol. Its IUPAC name is 1-(3,4-dimethylphenyl)-2-(oxan-4-ylsulfanyl)ethanone.
| Compound Name | 1-(3,4-dimethylphenyl)-2-(oxan-4-ylsulfanyl)ethanone |
|---|---|
| PubChem CID | 62997185 |
| Molecular Formula | C15H20O2S |
| Molecular Weight | 264.39 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | 1-(3,4-dimethylphenyl)-2-(oxan-4-ylsulfanyl)ethanone |
| SMILES | Cc1ccc(C(=O)CSC2CCOCC2)cc1C |
| InChI | InChI=1S/C15H20O2S/c1-11-3-4-13(9-12(11)2)15(16)10-18-14-5-7-17-8-6-14/h3-4,9,14H,5-8,10H2,1-2H3 |
| InChIKey | GZMYYPKPQFAHKE-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.39 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |