C12H16N4O2 — CID 62998473
1-[6-(methylamino)pyridine-3-carbonyl]-1,4-diazepan-5-one (PubChem CID 62998473) has the molecular formula C12H16N4O2 and a molecular weight of 248.29 g/mol. Its IUPAC name is 1-[6-(methylamino)pyridine-3-carbonyl]-1,4-diazepan-5-one.
| Compound Name | 1-[6-(methylamino)pyridine-3-carbonyl]-1,4-diazepan-5-one |
|---|---|
| PubChem CID | 62998473 |
| Molecular Formula | C12H16N4O2 |
| Molecular Weight | 248.29 g/mol |
| Exact Mass | 248.13 |
| IUPAC Name | 1-[6-(methylamino)pyridine-3-carbonyl]-1,4-diazepan-5-one |
| SMILES | CNc1ccc(C(=O)N2CCNC(=O)CC2)cn1 |
| InChI | InChI=1S/C12H16N4O2/c1-13-10-3-2-9(8-15-10)12(18)16-6-4-11(17)14-5-7-16/h2-3,8H,4-7H2,1H3,(H,13,15)(H,14,17) |
| InChIKey | STZDKDZEABTZRS-UHFFFAOYSA-N |
| XLogP | 0.09 |
| TPSA | 74.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.29 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |