C12H12N4O2S — CID 63000402
N-(3-cyanophenyl)-N,2-dimethyl-1H-imidazole-5-sulfonamide (PubChem CID 63000402) has the molecular formula C12H12N4O2S and a molecular weight of 276.32 g/mol. Its IUPAC name is N-(3-cyanophenyl)-N,2-dimethyl-1H-imidazole-5-sulfonamide.
| Compound Name | N-(3-cyanophenyl)-N,2-dimethyl-1H-imidazole-5-sulfonamide |
|---|---|
| PubChem CID | 63000402 |
| Molecular Formula | C12H12N4O2S |
| Molecular Weight | 276.32 g/mol |
| Exact Mass | 276.07 |
| IUPAC Name | N-(3-cyanophenyl)-N,2-dimethyl-1H-imidazole-5-sulfonamide |
| SMILES | Cc1ncc(S(=O)(=O)N(C)c2cccc(C#N)c2)[nH]1 |
| InChI | InChI=1S/C12H12N4O2S/c1-9-14-8-12(15-9)19(17,18)16(2)11-5-3-4-10(6-11)7-13/h3-6,8H,1-2H3,(H,14,15) |
| InChIKey | AOALLCRQRNNZJC-UHFFFAOYSA-N |
| XLogP | 1.41 |
| TPSA | 89.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.32 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |