C13H21N3O3S2 — CID 63002785
4-tert-butyl-2-(4-methylsulfonylpiperazin-1-yl)-1,3-thiazole-5-carbaldehyde (PubChem CID 63002785) has the molecular formula C13H21N3O3S2 and a molecular weight of 331.46 g/mol. Its IUPAC name is 4-tert-butyl-2-(4-methylsulfonylpiperazin-1-yl)-1,3-thiazole-5-carbaldehyde.
| Compound Name | 4-tert-butyl-2-(4-methylsulfonylpiperazin-1-yl)-1,3-thiazole-5-carbaldehyde |
|---|---|
| PubChem CID | 63002785 |
| Molecular Formula | C13H21N3O3S2 |
| Molecular Weight | 331.46 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 4-tert-butyl-2-(4-methylsulfonylpiperazin-1-yl)-1,3-thiazole-5-carbaldehyde |
| SMILES | CC(C)(C)c1nc(N2CCN(S(C)(=O)=O)CC2)sc1C=O |
| InChI | InChI=1S/C13H21N3O3S2/c1-13(2,3)11-10(9-17)20-12(14-11)15-5-7-16(8-6-15)21(4,18)19/h9H,5-8H2,1-4H3 |
| InChIKey | SCDXKDAHEKZLDL-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 70.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.46 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|