C14H15N3OS — CID 63026272
3-[2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol (PubChem CID 63026272) has the molecular formula C14H15N3OS and a molecular weight of 273.36 g/mol. Its IUPAC name is 3-[2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol.
| Compound Name | 3-[2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol |
|---|---|
| PubChem CID | 63026272 |
| Molecular Formula | C14H15N3OS |
| Molecular Weight | 273.36 g/mol |
| Exact Mass | 273.09 |
| IUPAC Name | 3-[2-(6,8-dihydro-5H-imidazo[1,2-a]pyrazin-7-ylmethyl)thiophen-3-yl]prop-2-yn-1-ol |
| SMILES | OCC#Cc1ccsc1CN1CCn2ccnc2C1 |
| InChI | InChI=1S/C14H15N3OS/c18-8-1-2-12-3-9-19-13(12)10-16-6-7-17-5-4-15-14(17)11-16/h3-5,9,18H,6-8,10-11H2 |
| InChIKey | HASIFSRJZYFODE-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 41.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.36 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|