C9H16N4 — CID 63032199
3-ethyl-1-methyl-5-pyrrolidin-3-yl-1,2,4-triazole (PubChem CID 63032199) has the molecular formula C9H16N4 and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-ethyl-1-methyl-5-pyrrolidin-3-yl-1,2,4-triazole.
| Compound Name | 3-ethyl-1-methyl-5-pyrrolidin-3-yl-1,2,4-triazole |
|---|---|
| PubChem CID | 63032199 |
| Molecular Formula | C9H16N4 |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.14 |
| IUPAC Name | 3-ethyl-1-methyl-5-pyrrolidin-3-yl-1,2,4-triazole |
| SMILES | CCc1nc(C2CCNC2)n(C)n1 |
| InChI | InChI=1S/C9H16N4/c1-3-8-11-9(13(2)12-8)7-4-5-10-6-7/h7,10H,3-6H2,1-2H3 |
| InChIKey | MKDRCPZPIYFOTB-UHFFFAOYSA-N |
| XLogP | 0.45 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |