C10H17N5 — CID 136840128
4-ethyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-3,5-diene (PubChem CID 136840128) has the molecular formula C10H17N5 and a molecular weight of 207.28 g/mol. Its IUPAC name is 4-ethyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-3,5-diene.
| Compound Name | 4-ethyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-3,5-diene |
|---|---|
| PubChem CID | 136840128 |
| Molecular Formula | C10H17N5 |
| Molecular Weight | 207.28 g/mol |
| Exact Mass | 207.15 |
| IUPAC Name | 4-ethyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-3,5-diene |
| SMILES | CCc1nc2n(n1)C1CCNCC1CN2 |
| InChI | InChI=1S/C10H17N5/c1-2-9-13-10-12-6-7-5-11-4-3-8(7)15(10)14-9/h7-8,11H,2-6H2,1H3,(H,12,13,14) |
| InChIKey | LOVFHRJTNHHBDK-UHFFFAOYSA-N |
| XLogP | 0.42 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.28 |
| LogP ≤ 5 | 0.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |