C10H18N6 — CID 136840288
7-piperidin-3-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 136840288) has the molecular formula C10H18N6 and a molecular weight of 222.30 g/mol. Its IUPAC name is 7-piperidin-3-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | 7-piperidin-3-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 136840288 |
| Molecular Formula | C10H18N6 |
| Molecular Weight | 222.30 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | 7-piperidin-3-yl-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | Nc1nc2n(n1)C(C1CCCNC1)CCN2 |
| InChI | InChI=1S/C10H18N6/c11-9-14-10-13-5-3-8(16(10)15-9)7-2-1-4-12-6-7/h7-8,12H,1-6H2,(H3,11,13,14,15) |
| InChIKey | ZXXIHURLVCKEPX-UHFFFAOYSA-N |
| XLogP | 0.22 |
| TPSA | 80.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.30 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |