C12H19N5 — CID 136840547
4-cyclobutyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-3,5-diene (PubChem CID 136840547) has the molecular formula C12H19N5 and a molecular weight of 233.32 g/mol. Its IUPAC name is 4-cyclobutyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-3,5-diene.
| Compound Name | 4-cyclobutyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-3,5-diene |
|---|---|
| PubChem CID | 136840547 |
| Molecular Formula | C12H19N5 |
| Molecular Weight | 233.32 g/mol |
| Exact Mass | 233.16 |
| IUPAC Name | 4-cyclobutyl-2,3,5,7,11-pentazatricyclo[7.4.0.02,6]trideca-3,5-diene |
| SMILES | C1CC(c2nc3n(n2)C2CCNCC2CN3)C1 |
| InChI | InChI=1S/C12H19N5/c1-2-8(3-1)11-15-12-14-7-9-6-13-5-4-10(9)17(12)16-11/h8-10,13H,1-7H2,(H,14,15,16) |
| InChIKey | QNQKKEIHUDJDSS-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 54.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |