C14H15F2NOS — CID 63038033
2-(2,3-difluorophenoxy)-N-(thiophen-2-ylmethyl)propan-1-amine (PubChem CID 63038033) has the molecular formula C14H15F2NOS and a molecular weight of 283.34 g/mol. Its IUPAC name is 2-(2,3-difluorophenoxy)-N-(thiophen-2-ylmethyl)propan-1-amine.
| Compound Name | 2-(2,3-difluorophenoxy)-N-(thiophen-2-ylmethyl)propan-1-amine |
|---|---|
| PubChem CID | 63038033 |
| Molecular Formula | C14H15F2NOS |
| Molecular Weight | 283.34 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 2-(2,3-difluorophenoxy)-N-(thiophen-2-ylmethyl)propan-1-amine |
| SMILES | CC(CNCc1cccs1)Oc1cccc(F)c1F |
| InChI | InChI=1S/C14H15F2NOS/c1-10(8-17-9-11-4-3-7-19-11)18-13-6-2-5-12(15)14(13)16/h2-7,10,17H,8-9H2,1H3 |
| InChIKey | JMKTURGTIYPYHK-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.34 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |