C12H18F3NOS — CID 82793135
N-(thiophen-2-ylmethyl)-2-(4,4,4-trifluorobutoxy)propan-1-amine (PubChem CID 82793135) has the molecular formula C12H18F3NOS and a molecular weight of 281.34 g/mol. Its IUPAC name is N-(thiophen-2-ylmethyl)-2-(4,4,4-trifluorobutoxy)propan-1-amine.
| Compound Name | N-(thiophen-2-ylmethyl)-2-(4,4,4-trifluorobutoxy)propan-1-amine |
|---|---|
| PubChem CID | 82793135 |
| Molecular Formula | C12H18F3NOS |
| Molecular Weight | 281.34 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | N-(thiophen-2-ylmethyl)-2-(4,4,4-trifluorobutoxy)propan-1-amine |
| SMILES | CC(CNCc1cccs1)OCCCC(F)(F)F |
| InChI | InChI=1S/C12H18F3NOS/c1-10(17-6-3-5-12(13,14)15)8-16-9-11-4-2-7-18-11/h2,4,7,10,16H,3,5-6,8-9H2,1H3 |
| InChIKey | PTJCDXQCASQOSX-UHFFFAOYSA-N |
| XLogP | 3.59 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.34 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|