C30H24BrN3O4 — CID 6304344
[4-[(Z)-[[2-[(2,2-diphenylacetyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate (PubChem CID 6304344) has the molecular formula C30H24BrN3O4 and a molecular weight of 570.44 g/mol. Its IUPAC name is [4-[(Z)-[[2-[(2,2-diphenylacetyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate.
| Compound Name | [4-[(Z)-[[2-[(2,2-diphenylacetyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate |
|---|---|
| PubChem CID | 6304344 |
| Molecular Formula | C30H24BrN3O4 |
| Molecular Weight | 570.44 g/mol |
| Exact Mass | 569.10 |
| IUPAC Name | [4-[(Z)-[[2-[(2,2-diphenylacetyl)amino]acetyl]hydrazinylidene]methyl]phenyl] 3-bromobenzoate |
| SMILES | O=C(CNC(=O)C(c1ccccc1)c1ccccc1)N/N=C\c1ccc(OC(=O)c2cccc(Br)c2)cc1 |
| InChI | InChI=1S/C30H24BrN3O4/c31-25-13-7-12-24(18-25)30(37)38-26-16-14-21(15-17-26)19-33-34-27(35)20-32-29(36)28(22-8-3-1-4-9-22)23-10-5-2-6-11-23/h1-19,28H,20H2,(H,32,36)(H,34,35)/b33-19- |
| InChIKey | ZAIRIUWNYLNHRP-APTWKGOFSA-N |
| XLogP | 5.07 |
| TPSA | 96.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.44 |
| LogP ≤ 5 | 5.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|