C16H14F3NO — CID 63050382
1-(2,3-dihydro-1-benzofuran-2-yl)-N-[(3,4,5-trifluorophenyl)methyl]methanamine (PubChem CID 63050382) has the molecular formula C16H14F3NO and a molecular weight of 293.29 g/mol. Its IUPAC name is 1-(2,3-dihydro-1-benzofuran-2-yl)-N-[(3,4,5-trifluorophenyl)methyl]methanamine.
| Compound Name | 1-(2,3-dihydro-1-benzofuran-2-yl)-N-[(3,4,5-trifluorophenyl)methyl]methanamine |
|---|---|
| PubChem CID | 63050382 |
| Molecular Formula | C16H14F3NO |
| Molecular Weight | 293.29 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 1-(2,3-dihydro-1-benzofuran-2-yl)-N-[(3,4,5-trifluorophenyl)methyl]methanamine |
| SMILES | Fc1cc(CNCC2Cc3ccccc3O2)cc(F)c1F |
| InChI | InChI=1S/C16H14F3NO/c17-13-5-10(6-14(18)16(13)19)8-20-9-12-7-11-3-1-2-4-15(11)21-12/h1-6,12,20H,7-9H2 |
| InChIKey | WCQSJAWHXUZQKC-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.29 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|