C14H18N4OS — CID 63054769
2-(ethylamino)-4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]butanenitrile (PubChem CID 63054769) has the molecular formula C14H18N4OS and a molecular weight of 290.39 g/mol. Its IUPAC name is 2-(ethylamino)-4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]butanenitrile.
| Compound Name | 2-(ethylamino)-4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]butanenitrile |
|---|---|
| PubChem CID | 63054769 |
| Molecular Formula | C14H18N4OS |
| Molecular Weight | 290.39 g/mol |
| Exact Mass | 290.12 |
| IUPAC Name | 2-(ethylamino)-4-[(6-methoxy-1H-benzimidazol-2-yl)sulfanyl]butanenitrile |
| SMILES | CCNC(C#N)CCSc1nc2ccc(OC)cc2[nH]1 |
| InChI | InChI=1S/C14H18N4OS/c1-3-16-10(9-15)6-7-20-14-17-12-5-4-11(19-2)8-13(12)18-14/h4-5,8,10,16H,3,6-7H2,1-2H3,(H,17,18) |
| InChIKey | JAYDAARQKXORGS-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 73.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.39 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |