C9H20N2O3 — CID 63055017
4-[2-methoxyethyl(methyl)amino]-2-(methylamino)butanoic acid (PubChem CID 63055017) has the molecular formula C9H20N2O3 and a molecular weight of 204.27 g/mol. Its IUPAC name is 4-[2-methoxyethyl(methyl)amino]-2-(methylamino)butanoic acid.
| Compound Name | 4-[2-methoxyethyl(methyl)amino]-2-(methylamino)butanoic acid |
|---|---|
| PubChem CID | 63055017 |
| Molecular Formula | C9H20N2O3 |
| Molecular Weight | 204.27 g/mol |
| Exact Mass | 204.15 |
| IUPAC Name | 4-[2-methoxyethyl(methyl)amino]-2-(methylamino)butanoic acid |
| SMILES | CNC(CCN(C)CCOC)C(=O)O |
| InChI | InChI=1S/C9H20N2O3/c1-10-8(9(12)13)4-5-11(2)6-7-14-3/h8,10H,4-7H2,1-3H3,(H,12,13) |
| InChIKey | YLPQGGXDUBJTTE-UHFFFAOYSA-N |
| XLogP | -0.37 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 204.27 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |