C14H19F5N2 — CID 63058991
2,6-difluoro-N-methyl-4-[(2-methylpropylamino)methyl]-N-(2,2,2-trifluoroethyl)aniline (PubChem CID 63058991) has the molecular formula C14H19F5N2 and a molecular weight of 310.31 g/mol. Its IUPAC name is 2,6-difluoro-N-methyl-4-[(2-methylpropylamino)methyl]-N-(2,2,2-trifluoroethyl)aniline.
| Compound Name | 2,6-difluoro-N-methyl-4-[(2-methylpropylamino)methyl]-N-(2,2,2-trifluoroethyl)aniline |
|---|---|
| PubChem CID | 63058991 |
| Molecular Formula | C14H19F5N2 |
| Molecular Weight | 310.31 g/mol |
| Exact Mass | 310.15 |
| IUPAC Name | 2,6-difluoro-N-methyl-4-[(2-methylpropylamino)methyl]-N-(2,2,2-trifluoroethyl)aniline |
| SMILES | CC(C)CNCc1cc(F)c(N(C)CC(F)(F)F)c(F)c1 |
| InChI | InChI=1S/C14H19F5N2/c1-9(2)6-20-7-10-4-11(15)13(12(16)5-10)21(3)8-14(17,18)19/h4-5,9,20H,6-8H2,1-3H3 |
| InChIKey | STPCYYJYSUJZNR-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.31 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|