C15H22N4OS — CID 63059993
2-methoxy-N-[(2-thiomorpholin-4-ylimidazo[1,2-a]pyridin-3-yl)methyl]ethanamine (PubChem CID 63059993) has the molecular formula C15H22N4OS and a molecular weight of 306.44 g/mol. Its IUPAC name is 2-methoxy-N-[(2-thiomorpholin-4-ylimidazo[1,2-a]pyridin-3-yl)methyl]ethanamine.
| Compound Name | 2-methoxy-N-[(2-thiomorpholin-4-ylimidazo[1,2-a]pyridin-3-yl)methyl]ethanamine |
|---|---|
| PubChem CID | 63059993 |
| Molecular Formula | C15H22N4OS |
| Molecular Weight | 306.44 g/mol |
| Exact Mass | 306.15 |
| IUPAC Name | 2-methoxy-N-[(2-thiomorpholin-4-ylimidazo[1,2-a]pyridin-3-yl)methyl]ethanamine |
| SMILES | COCCNCc1c(N2CCSCC2)nc2ccccn12 |
| InChI | InChI=1S/C15H22N4OS/c1-20-9-5-16-12-13-15(18-7-10-21-11-8-18)17-14-4-2-3-6-19(13)14/h2-4,6,16H,5,7-12H2,1H3 |
| InChIKey | PRLGVNFEECSJHE-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 41.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.44 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|