C13H16N6OS — CID 63805231
2-methoxy-N-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)imidazo[1,2-a]pyridin-3-yl]methyl]ethanamine (PubChem CID 63805231) has the molecular formula C13H16N6OS and a molecular weight of 304.38 g/mol. Its IUPAC name is 2-methoxy-N-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)imidazo[1,2-a]pyridin-3-yl]methyl]ethanamine.
| Compound Name | 2-methoxy-N-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)imidazo[1,2-a]pyridin-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 63805231 |
| Molecular Formula | C13H16N6OS |
| Molecular Weight | 304.38 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 2-methoxy-N-[[2-(1H-1,2,4-triazol-5-ylsulfanyl)imidazo[1,2-a]pyridin-3-yl]methyl]ethanamine |
| SMILES | COCCNCc1c(Sc2ncn[nH]2)nc2ccccn12 |
| InChI | InChI=1S/C13H16N6OS/c1-20-7-5-14-8-10-12(21-13-15-9-16-18-13)17-11-4-2-3-6-19(10)11/h2-4,6,9,14H,5,7-8H2,1H3,(H,15,16,18) |
| InChIKey | IQOSTGAFVANPRG-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 80.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.38 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|